C15H17N3O2S — CID 80550057
2-[(3-amino-2-methyl-3-phenylpropanoyl)amino]thiophene-3-carboxamide (PubChem CID 80550057) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-[(3-amino-2-methyl-3-phenylpropanoyl)amino]thiophene-3-carboxamide.
| Compound Name | 2-[(3-amino-2-methyl-3-phenylpropanoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 80550057 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[(3-amino-2-methyl-3-phenylpropanoyl)amino]thiophene-3-carboxamide |
| SMILES | CC(C(=O)Nc1sccc1C(N)=O)C(N)c1ccccc1 |
| InChI | InChI=1S/C15H17N3O2S/c1-9(12(16)10-5-3-2-4-6-10)14(20)18-15-11(13(17)19)7-8-21-15/h2-9,12H,16H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | ZSCMIWRBWBRCIA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |