C21H22N3O2S+ — CID 9445948
benzhydryl-[(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl]azanium (PubChem CID 9445948) has the molecular formula C21H22N3O2S+ and a molecular weight of 380.49 g/mol. Its IUPAC name is benzhydryl-[(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl]azanium.
| Compound Name | benzhydryl-[(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9445948 |
| Molecular Formula | C21H22N3O2S+ |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | benzhydryl-[(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl]azanium |
| SMILES | C[C@@H]([NH2+]C(c1ccccc1)c1ccccc1)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C21H21N3O2S/c1-14(20(26)24-21-17(19(22)25)12-13-27-21)23-18(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14,18,23H,1H3,(H2,22,25)(H,24,26)/p+1/t14-/m1/s1 |
| InChIKey | OAGJKEJXWBEVAH-CQSZACIVSA-O |
| XLogP | 2.53 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |