C16H20N3O2S+ — CID 9248820
[(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl]-[(1S)-1-phenylethyl]azanium (PubChem CID 9248820) has the molecular formula C16H20N3O2S+ and a molecular weight of 318.42 g/mol. Its IUPAC name is [(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl]-[(1S)-1-phenylethyl]azanium.
| Compound Name | [(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl]-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 9248820 |
| Molecular Formula | C16H20N3O2S+ |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl]-[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+][C@H](C)C(=O)Nc1sccc1C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-10(12-6-4-3-5-7-12)18-11(2)15(21)19-16-13(14(17)20)8-9-22-16/h3-11,18H,1-2H3,(H2,17,20)(H,19,21)/p+1/t10-,11+/m0/s1 |
| InChIKey | IWMCDLGIXPNMRN-WDEREUQCSA-O |
| XLogP | 1.50 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |