C19H16N2O2S2 — CID 7346644
2-[[(2R)-2-phenyl-2-phenylsulfanylacetyl]amino]thiophene-3-carboxamide (PubChem CID 7346644) has the molecular formula C19H16N2O2S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[[(2R)-2-phenyl-2-phenylsulfanylacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[(2R)-2-phenyl-2-phenylsulfanylacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 7346644 |
| Molecular Formula | C19H16N2O2S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-[[(2R)-2-phenyl-2-phenylsulfanylacetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O2S2/c20-17(22)15-11-12-24-19(15)21-18(23)16(13-7-3-1-4-8-13)25-14-9-5-2-6-10-14/h1-12,16H,(H2,20,22)(H,21,23)/t16-/m1/s1 |
| InChIKey | MTQLZLZMVOCUEK-MRXNPFEDSA-N |
| XLogP | 4.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |