C12H16N3OS+ — CID 9275051
(2R)-N-(3-cyanothiophen-2-yl)-2-pyrrolidin-1-ium-1-ylpropanamide (PubChem CID 9275051) has the molecular formula C12H16N3OS+ and a molecular weight of 250.35 g/mol. Its IUPAC name is (2R)-N-(3-cyanothiophen-2-yl)-2-pyrrolidin-1-ium-1-ylpropanamide.
| Compound Name | (2R)-N-(3-cyanothiophen-2-yl)-2-pyrrolidin-1-ium-1-ylpropanamide |
|---|---|
| PubChem CID | 9275051 |
| Molecular Formula | C12H16N3OS+ |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2R)-N-(3-cyanothiophen-2-yl)-2-pyrrolidin-1-ium-1-ylpropanamide |
| SMILES | C[C@H](C(=O)Nc1sccc1C#N)[NH+]1CCCC1 |
| InChI | InChI=1S/C12H15N3OS/c1-9(15-5-2-3-6-15)11(16)14-12-10(8-13)4-7-17-12/h4,7,9H,2-3,5-6H2,1H3,(H,14,16)/p+1/t9-/m1/s1 |
| InChIKey | MJDMWCVLITYIEO-SECBINFHSA-O |
| XLogP | 0.63 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |