C13H18N3OS+ — CID 9249660
(2R)-N-(3-cyanothiophen-2-yl)-2-piperidin-1-ium-1-ylpropanamide (PubChem CID 9249660) has the molecular formula C13H18N3OS+ and a molecular weight of 264.37 g/mol. Its IUPAC name is (2R)-N-(3-cyanothiophen-2-yl)-2-piperidin-1-ium-1-ylpropanamide.
| Compound Name | (2R)-N-(3-cyanothiophen-2-yl)-2-piperidin-1-ium-1-ylpropanamide |
|---|---|
| PubChem CID | 9249660 |
| Molecular Formula | C13H18N3OS+ |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R)-N-(3-cyanothiophen-2-yl)-2-piperidin-1-ium-1-ylpropanamide |
| SMILES | C[C@H](C(=O)Nc1sccc1C#N)[NH+]1CCCCC1 |
| InChI | InChI=1S/C13H17N3OS/c1-10(16-6-3-2-4-7-16)12(17)15-13-11(9-14)5-8-18-13/h5,8,10H,2-4,6-7H2,1H3,(H,15,17)/p+1/t10-/m1/s1 |
| InChIKey | JIDZXNNKTSAUCP-SNVBAGLBSA-O |
| XLogP | 1.02 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |