C23H24FN2O+ — CID 9445898
benzhydryl-[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl]azanium (PubChem CID 9445898) has the molecular formula C23H24FN2O+ and a molecular weight of 363.46 g/mol. Its IUPAC name is benzhydryl-[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl]azanium.
| Compound Name | benzhydryl-[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9445898 |
| Molecular Formula | C23H24FN2O+ |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | benzhydryl-[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl]azanium |
| SMILES | C[C@H]([NH2+]C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O/c1-17(23(27)25-16-18-12-14-21(24)15-13-18)26-22(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,17,22,26H,16H2,1H3,(H,25,27)/p+1/t17-/m0/s1 |
| InChIKey | OVCGBRCDIHLZPI-KRWDZBQOSA-O |
| XLogP | 3.18 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |