C16H16N2O3S2 — CID 9447827
ethyl (2Z)-2-[(5Z)-5-[(4-acetamidophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-ylidene]acetate (PubChem CID 9447827) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl (2Z)-2-[(5Z)-5-[(4-acetamidophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(5Z)-5-[(4-acetamidophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-ylidene]acetate |
|---|---|
| PubChem CID | 9447827 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | ethyl (2Z)-2-[(5Z)-5-[(4-acetamidophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=c1\[nH]c(=S)s\c1=C/c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C16H16N2O3S2/c1-3-21-15(20)9-13-14(23-16(22)18-13)8-11-4-6-12(7-5-11)17-10(2)19/h4-9H,3H2,1-2H3,(H,17,19)(H,18,22)/b13-9-,14-8- |
| InChIKey | YLPBPUKNKPVWJZ-RDBXOABQSA-N |
| XLogP | 1.94 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|