C18H22N2O4 — CID 94487246
(2S)-4-[2-[(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-oxoethyl]-2-methyl-1,4-benzoxazin-3-one (PubChem CID 94487246) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (2S)-4-[2-[(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-oxoethyl]-2-methyl-1,4-benzoxazin-3-one.
| Compound Name | (2S)-4-[2-[(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-oxoethyl]-2-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 94487246 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (2S)-4-[2-[(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-oxoethyl]-2-methyl-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1Oc2ccccc2N(CC(=O)N2CCO[C@H]3CCC[C@@H]32)C1=O |
| InChI | InChI=1S/C18H22N2O4/c1-12-18(22)20(14-5-2-3-7-16(14)24-12)11-17(21)19-9-10-23-15-8-4-6-13(15)19/h2-3,5,7,12-13,15H,4,6,8-11H2,1H3/t12-,13-,15-/m0/s1 |
| InChIKey | QYDPGXXGGPUOBS-YDHLFZDLSA-N |
| XLogP | 1.58 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |