C19H16F2N4O4 — CID 9449450
(6S)-N-(3,4-difluorophenyl)-3,4-dimethyl-6-(3-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 9449450) has the molecular formula C19H16F2N4O4 and a molecular weight of 402.36 g/mol. Its IUPAC name is (6S)-N-(3,4-difluorophenyl)-3,4-dimethyl-6-(3-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | (6S)-N-(3,4-difluorophenyl)-3,4-dimethyl-6-(3-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 9449450 |
| Molecular Formula | C19H16F2N4O4 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (6S)-N-(3,4-difluorophenyl)-3,4-dimethyl-6-(3-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(F)c(F)c2)[C@H](c2cccc([N+](=O)[O-])c2)NC(=O)N1C |
| InChI | InChI=1S/C19H16F2N4O4/c1-10-16(18(26)22-12-6-7-14(20)15(21)9-12)17(23-19(27)24(10)2)11-4-3-5-13(8-11)25(28)29/h3-9,17H,1-2H3,(H,22,26)(H,23,27)/t17-/m0/s1 |
| InChIKey | BECLDZVWLUHMGU-KRWDZBQOSA-N |
| XLogP | 3.48 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|