C16H16ClN5O — CID 94497913
N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-4-methoxypyrimidin-2-amine (PubChem CID 94497913) has the molecular formula C16H16ClN5O and a molecular weight of 329.79 g/mol. Its IUPAC name is N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-4-methoxypyrimidin-2-amine.
| Compound Name | N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 94497913 |
| Molecular Formula | C16H16ClN5O |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-4-methoxypyrimidin-2-amine |
| SMILES | COc1ccnc(N[C@H](c2ccc(Cl)cc2)c2nccn2C)n1 |
| InChI | InChI=1S/C16H16ClN5O/c1-22-10-9-18-15(22)14(11-3-5-12(17)6-4-11)21-16-19-8-7-13(20-16)23-2/h3-10,14H,1-2H3,(H,19,20,21)/t14-/m1/s1 |
| InChIKey | SDDLUFAJKDFPAD-CQSZACIVSA-N |
| XLogP | 3.07 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |