C16H23N3O2S — CID 94502471
1-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(1-cyclopropylimidazol-2-yl)sulfanylethanone (PubChem CID 94502471) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(1-cyclopropylimidazol-2-yl)sulfanylethanone.
| Compound Name | 1-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(1-cyclopropylimidazol-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 94502471 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(1-cyclopropylimidazol-2-yl)sulfanylethanone |
| SMILES | O=C(CSc1nccn1C1CC1)N1CCO[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C16H23N3O2S/c20-15(11-22-16-17-7-8-18(16)12-5-6-12)19-9-10-21-14-4-2-1-3-13(14)19/h7-8,12-14H,1-6,9-11H2/t13-,14+/m0/s1 |
| InChIKey | OLPVDWWQMMMWBY-UONOGXRCSA-N |
| XLogP | 2.48 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |