C15H18N4O2S — CID 94503656
1-benzyl-1-[[(2S)-oxolan-2-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 94503656) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 1-benzyl-1-[[(2S)-oxolan-2-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-benzyl-1-[[(2S)-oxolan-2-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 94503656 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-benzyl-1-[[(2S)-oxolan-2-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(Nc1nncs1)N(Cc1ccccc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H18N4O2S/c20-15(17-14-18-16-11-22-14)19(10-13-7-4-8-21-13)9-12-5-2-1-3-6-12/h1-3,5-6,11,13H,4,7-10H2,(H,17,18,20)/t13-/m0/s1 |
| InChIKey | LIMBJJRTKJTLCA-ZDUSSCGKSA-N |
| XLogP | 2.75 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |