About [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate
[(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate (PubChem CID 9453024) has the molecular formula C14H16ClNO6S
and a molecular weight of 361.80 g/mol. Its IUPAC name is [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate |
| PubChem CID | 9453024 |
| Molecular Formula | C14H16ClNO6S |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate |
| SMILES | C[C@H]1C[C@@H](OC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)C)c2)C(=O)O1 |
| InChI | InChI=1S/C14H16ClNO6S/c1-8-6-11(14(18)21-8)22-13(17)9-4-5-10(15)12(7-9)23(19,20)16(2)3/h4-5,7-8,11H,6H2,1-3H3/t8-,11+/m0/s1 |
| InChIKey | TVAITNYHYTVWEX-GZMMTYOYSA-N |
| XLogP | 1.45 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate?
The IUPAC name of [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate (CID 9453024) is [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate.
What is the SMILES notation for [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate?
The canonical SMILES for [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate is C[C@H]1C[C@@H](OC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)C)c2)C(=O)O1.
What is the InChIKey of [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate?
The InChIKey is TVAITNYHYTVWEX-GZMMTYOYSA-N. The full InChI is InChI=1S/C14H16ClNO6S/c1-8-6-11(14(18)21-8)22-13(17)9-4-5-10(15)12(7-9)23(19,20)16(2)3/h4-5,7-8,11H,6H2,1-3H3/t8-,11+/m0/s1.
What are the key properties of [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate?
[(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate has a molecular weight of 361.80 g/mol, XLogP of 1.45, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-(dimethylsulfamoyl)benzoate is sourced from PubChem (CID 9453024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).