C14H16ClNO7S — CID 8722309
[(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate (PubChem CID 8722309) has the molecular formula C14H16ClNO7S and a molecular weight of 377.80 g/mol. Its IUPAC name is [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate.
| Compound Name | [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8722309 |
| Molecular Formula | C14H16ClNO7S |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-chloro-3-[methoxy(methyl)sulfamoyl]benzoate |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)O[C@H]2C[C@@H](C)OC2=O)ccc1Cl |
| InChI | InChI=1S/C14H16ClNO7S/c1-8-6-11(14(18)22-8)23-13(17)9-4-5-10(15)12(7-9)24(19,20)16(2)21-3/h4-5,7-8,11H,6H2,1-3H3/t8-,11+/m1/s1 |
| InChIKey | BJVWXXBLLGVQED-KCJUWKMLSA-N |
| XLogP | 1.38 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|