C15H22N2O3S — CID 9453372
(3S)-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]-N-(4-methylphenyl)butanamide (PubChem CID 9453372) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is (3S)-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]-N-(4-methylphenyl)butanamide.
| Compound Name | (3S)-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]-N-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 9453372 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (3S)-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]-N-(4-methylphenyl)butanamide |
| SMILES | Cc1ccc(NC(=O)C[C@H](C)N[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H22N2O3S/c1-11-3-5-13(6-4-11)17-15(18)9-12(2)16-14-7-8-21(19,20)10-14/h3-6,12,14,16H,7-10H2,1-2H3,(H,17,18)/t12-,14-/m0/s1 |
| InChIKey | JRDSCURZUMXSHH-JSGCOSHPSA-N |
| XLogP | 1.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |