C19H31N3O3 — CID 9453380
(3S)-N-(4-methoxyphenyl)-3-[(2-methyl-2-morpholin-4-ylpropyl)amino]butanamide (PubChem CID 9453380) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is (3S)-N-(4-methoxyphenyl)-3-[(2-methyl-2-morpholin-4-ylpropyl)amino]butanamide.
| Compound Name | (3S)-N-(4-methoxyphenyl)-3-[(2-methyl-2-morpholin-4-ylpropyl)amino]butanamide |
|---|---|
| PubChem CID | 9453380 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (3S)-N-(4-methoxyphenyl)-3-[(2-methyl-2-morpholin-4-ylpropyl)amino]butanamide |
| SMILES | COc1ccc(NC(=O)C[C@H](C)NCC(C)(C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H31N3O3/c1-15(20-14-19(2,3)22-9-11-25-12-10-22)13-18(23)21-16-5-7-17(24-4)8-6-16/h5-8,15,20H,9-14H2,1-4H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | YYWPLHNSQIBDRK-HNNXBMFYSA-N |
| XLogP | 2.11 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |