C19H22FN3O2 — CID 9453506
4-fluoro-N'-[(2S)-2-[methyl-[(2-methylphenyl)methyl]amino]propanoyl]benzohydrazide (PubChem CID 9453506) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 4-fluoro-N'-[(2S)-2-[methyl-[(2-methylphenyl)methyl]amino]propanoyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[(2S)-2-[methyl-[(2-methylphenyl)methyl]amino]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9453506 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 4-fluoro-N'-[(2S)-2-[methyl-[(2-methylphenyl)methyl]amino]propanoyl]benzohydrazide |
| SMILES | Cc1ccccc1CN(C)[C@@H](C)C(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FN3O2/c1-13-6-4-5-7-16(13)12-23(3)14(2)18(24)21-22-19(25)15-8-10-17(20)11-9-15/h4-11,14H,12H2,1-3H3,(H,21,24)(H,22,25)/t14-/m0/s1 |
| InChIKey | VYFLGYSLGOCCDH-AWEZNQCLSA-N |
| XLogP | 2.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|