C19H23FN3O2+ — CID 9453505
[(2S)-1-[2-(4-fluorobenzoyl)hydrazinyl]-1-oxopropan-2-yl]-methyl-[(2-methylphenyl)methyl]azanium (PubChem CID 9453505) has the molecular formula C19H23FN3O2+ and a molecular weight of 344.41 g/mol. Its IUPAC name is [(2S)-1-[2-(4-fluorobenzoyl)hydrazinyl]-1-oxopropan-2-yl]-methyl-[(2-methylphenyl)methyl]azanium.
| Compound Name | [(2S)-1-[2-(4-fluorobenzoyl)hydrazinyl]-1-oxopropan-2-yl]-methyl-[(2-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9453505 |
| Molecular Formula | C19H23FN3O2+ |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [(2S)-1-[2-(4-fluorobenzoyl)hydrazinyl]-1-oxopropan-2-yl]-methyl-[(2-methylphenyl)methyl]azanium |
| SMILES | Cc1ccccc1C[NH+](C)[C@@H](C)C(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FN3O2/c1-13-6-4-5-7-16(13)12-23(3)14(2)18(24)21-22-19(25)15-8-10-17(20)11-9-15/h4-11,14H,12H2,1-3H3,(H,21,24)(H,22,25)/p+1/t14-/m0/s1 |
| InChIKey | VYFLGYSLGOCCDH-AWEZNQCLSA-O |
| XLogP | 1.00 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|