C22H27FN4O2 — CID 9441563
4-fluoro-N'-[(2R)-2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]propanoyl]benzohydrazide (PubChem CID 9441563) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 4-fluoro-N'-[(2R)-2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]propanoyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[(2R)-2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9441563 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-fluoro-N'-[(2R)-2-[4-[(2-methylphenyl)methyl]piperazin-1-yl]propanoyl]benzohydrazide |
| SMILES | Cc1ccccc1CN1CCN([C@H](C)C(=O)NNC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H27FN4O2/c1-16-5-3-4-6-19(16)15-26-11-13-27(14-12-26)17(2)21(28)24-25-22(29)18-7-9-20(23)10-8-18/h3-10,17H,11-15H2,1-2H3,(H,24,28)(H,25,29)/t17-/m1/s1 |
| InChIKey | HRGGYQTYXJNMON-QGZVFWFLSA-N |
| XLogP | 2.10 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|