C17H16F2N4O — CID 94539435
N-[(E)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]-3-methoxyaniline (PubChem CID 94539435) has the molecular formula C17H16F2N4O and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[(E)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]-3-methoxyaniline.
| Compound Name | N-[(E)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]-3-methoxyaniline |
|---|---|
| PubChem CID | 94539435 |
| Molecular Formula | C17H16F2N4O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[(E)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]-3-methoxyaniline |
| SMILES | COc1cccc(N/N=C(\C)c2nc3ccccc3n2C(F)F)c1 |
| InChI | InChI=1S/C17H16F2N4O/c1-11(21-22-12-6-5-7-13(10-12)24-2)16-20-14-8-3-4-9-15(14)23(16)17(18)19/h3-10,17,22H,1-2H3/b21-11+ |
| InChIKey | BPMWQMWMXPGHAF-SRZZPIQSSA-N |
| XLogP | 4.28 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|