C19H16F5N3O2 — CID 55921632
(Z)-1-[1-(difluoromethyl)benzimidazol-2-yl]-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methoxy]ethanimine (PubChem CID 55921632) has the molecular formula C19H16F5N3O2 and a molecular weight of 413.35 g/mol. Its IUPAC name is (Z)-1-[1-(difluoromethyl)benzimidazol-2-yl]-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methoxy]ethanimine.
| Compound Name | (Z)-1-[1-(difluoromethyl)benzimidazol-2-yl]-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 55921632 |
| Molecular Formula | C19H16F5N3O2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (Z)-1-[1-(difluoromethyl)benzimidazol-2-yl]-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methoxy]ethanimine |
| SMILES | C/C(=N/OCc1cccc(OCC(F)(F)F)c1)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C19H16F5N3O2/c1-12(17-25-15-7-2-3-8-16(15)27(17)18(20)21)26-29-10-13-5-4-6-14(9-13)28-11-19(22,23)24/h2-9,18H,10-11H2,1H3/b26-12- |
| InChIKey | NLQONJGNLMVFHY-ZRGSRPPYSA-N |
| XLogP | 5.31 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|