C15H19F2N3O2 — CID 126807599
4-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]oxy-2-methylbutan-2-ol (PubChem CID 126807599) has the molecular formula C15H19F2N3O2 and a molecular weight of 311.33 g/mol. Its IUPAC name is 4-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]oxy-2-methylbutan-2-ol.
| Compound Name | 4-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]oxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 126807599 |
| Molecular Formula | C15H19F2N3O2 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethylideneamino]oxy-2-methylbutan-2-ol |
| SMILES | CC(=NOCCC(C)(C)O)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C15H19F2N3O2/c1-10(19-22-9-8-15(2,3)21)13-18-11-6-4-5-7-12(11)20(13)14(16)17/h4-7,14,21H,8-9H2,1-3H3 |
| InChIKey | IYCBLFVRHAMIHS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|