C19H17ClN2O4S2 — CID 94545296
(2S)-2-[(5Z)-5-[(5-chloro-8-methoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid (PubChem CID 94545296) has the molecular formula C19H17ClN2O4S2 and a molecular weight of 436.94 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[(5-chloro-8-methoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(5Z)-5-[(5-chloro-8-methoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 94545296 |
| Molecular Formula | C19H17ClN2O4S2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | (2S)-2-[(5Z)-5-[(5-chloro-8-methoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid |
| SMILES | COc1ccc(Cl)c2ccc(/C=C3\SC(=S)N([C@H](C(=O)O)C(C)C)C3=O)nc12 |
| InChI | InChI=1S/C19H17ClN2O4S2/c1-9(2)16(18(24)25)22-17(23)14(28-19(22)27)8-10-4-5-11-12(20)6-7-13(26-3)15(11)21-10/h4-9,16H,1-3H3,(H,24,25)/b14-8-/t16-/m0/s1 |
| InChIKey | RHFBJJRBXZQROT-VCHSTOLQSA-N |
| XLogP | 4.21 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|