C10H11Cl2N — CID 94556817
[(1S,2S)-2-(3,4-dichlorophenyl)cyclopropyl]methanamine (PubChem CID 94556817) has the molecular formula C10H11Cl2N and a molecular weight of 216.11 g/mol. Its IUPAC name is [(1S,2S)-2-(3,4-dichlorophenyl)cyclopropyl]methanamine.
| Compound Name | [(1S,2S)-2-(3,4-dichlorophenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 94556817 |
| Molecular Formula | C10H11Cl2N |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | [(1S,2S)-2-(3,4-dichlorophenyl)cyclopropyl]methanamine |
| SMILES | NC[C@H]1C[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2N/c11-9-2-1-6(4-10(9)12)8-3-7(8)5-13/h1-2,4,7-8H,3,5,13H2/t7-,8-/m1/s1 |
| InChIKey | WGNPNDWGKKHMPM-HTQZYQBOSA-N |
| XLogP | 3.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |