C11H12Cl2S — CID 174261126
[2-(3,4-dichlorophenyl)cyclobutyl]methanethiol (PubChem CID 174261126) has the molecular formula C11H12Cl2S and a molecular weight of 247.19 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol.
| Compound Name | [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol |
|---|---|
| PubChem CID | 174261126 |
| Molecular Formula | C11H12Cl2S |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol |
| SMILES | SCC1CCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2S/c12-10-4-2-7(5-11(10)13)9-3-1-8(9)6-14/h2,4-5,8-9,14H,1,3,6H2 |
| InChIKey | ZGCRRHRKOYXLTP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|