About [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol
[2-(3,4-dichlorophenyl)cyclobutyl]methanethiol (PubChem CID 174261126) has the molecular formula C11H12Cl2S
and a molecular weight of 247.19 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol.
Molecular Properties
| Compound Name | [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol |
| PubChem CID | 174261126 |
| Molecular Formula | C11H12Cl2S |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol |
| SMILES | SCC1CCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2S/c12-10-4-2-7(5-11(10)13)9-3-1-8(9)6-14/h2,4-5,8-9,14H,1,3,6H2 |
| InChIKey | ZGCRRHRKOYXLTP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol?
The IUPAC name of [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol (CID 174261126) is [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol.
What is the SMILES notation for [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol?
The canonical SMILES for [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol is SCC1CCC1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol?
The InChIKey is ZGCRRHRKOYXLTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2S/c12-10-4-2-7(5-11(10)13)9-3-1-8(9)6-14/h2,4-5,8-9,14H,1,3,6H2.
What are the key properties of [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol?
[2-(3,4-dichlorophenyl)cyclobutyl]methanethiol has a molecular weight of 247.19 g/mol, XLogP of 4.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dichlorophenyl)cyclobutyl]methanethiol is sourced from PubChem (CID 174261126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).