C20H22N2O5 — CID 9456421
(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[(3-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 9456421) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[(3-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[(3-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 9456421 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[(3-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1cccc(CNC(=O)/C=C/c2ccc(OCC(N)=O)c(OC)c2)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-25-16-5-3-4-15(10-16)12-22-20(24)9-7-14-6-8-17(18(11-14)26-2)27-13-19(21)23/h3-11H,12-13H2,1-2H3,(H2,21,23)(H,22,24)/b9-7+ |
| InChIKey | ZHFKQWOAPANQOW-VQHVLOKHSA-N |
| XLogP | 1.90 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|