C17H24N4O2 — CID 94643349
[(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methanone (PubChem CID 94643349) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methanone.
| Compound Name | [(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 94643349 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [(4aS,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methanone |
| SMILES | O=C([C@@H]1CCCN(c2ncccn2)C1)N1CCO[C@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C17H24N4O2/c22-16(21-10-11-23-15-6-1-5-14(15)21)13-4-2-9-20(12-13)17-18-7-3-8-19-17/h3,7-8,13-15H,1-2,4-6,9-12H2/t13-,14+,15+/m1/s1 |
| InChIKey | GQHVQYXQTHNJCV-ILXRZTDVSA-N |
| XLogP | 1.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |