C13H9F5N2 — CID 9466525
N-[(Z)-[(1S,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2,3,4,5,6-pentafluoroaniline (PubChem CID 9466525) has the molecular formula C13H9F5N2 and a molecular weight of 288.22 g/mol. Its IUPAC name is N-[(Z)-[(1S,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[(Z)-[(1S,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 9466525 |
| Molecular Formula | C13H9F5N2 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-[(Z)-[(1S,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2,3,4,5,6-pentafluoroaniline |
| SMILES | Fc1c(F)c(F)c(N/N=C2/C[C@H]3C=CC[C@H]23)c(F)c1F |
| InChI | InChI=1S/C13H9F5N2/c14-8-9(15)11(17)13(12(18)10(8)16)20-19-7-4-5-2-1-3-6(5)7/h1-2,5-6,20H,3-4H2/b19-7-/t5-,6+/m1/s1 |
| InChIKey | JSXVWHCRHBACPQ-ZZBWHZSISA-N |
| XLogP | 3.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|