C13H13F5N2 — CID 9466443
2,3,4,5,6-pentafluoro-N-[(4-methylcyclohexylidene)amino]aniline (PubChem CID 9466443) has the molecular formula C13H13F5N2 and a molecular weight of 292.25 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(4-methylcyclohexylidene)amino]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(4-methylcyclohexylidene)amino]aniline |
|---|---|
| PubChem CID | 9466443 |
| Molecular Formula | C13H13F5N2 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(4-methylcyclohexylidene)amino]aniline |
| SMILES | CC1CCC(=NNc2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C13H13F5N2/c1-6-2-4-7(5-3-6)19-20-13-11(17)9(15)8(14)10(16)12(13)18/h6,20H,2-5H2,1H3/b19-7- |
| InChIKey | KANOQUOTABBZNG-GXHLCREISA-N |
| XLogP | 4.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|