C13H23N3O3 — CID 94671243
tert-butyl N-[3-[[(2S)-2-cyanopropyl]-methylamino]-3-oxopropyl]carbamate (PubChem CID 94671243) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl N-[3-[[(2S)-2-cyanopropyl]-methylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(2S)-2-cyanopropyl]-methylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 94671243 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | tert-butyl N-[3-[[(2S)-2-cyanopropyl]-methylamino]-3-oxopropyl]carbamate |
| SMILES | C[C@H](C#N)CN(C)C(=O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23N3O3/c1-10(8-14)9-16(5)11(17)6-7-15-12(18)19-13(2,3)4/h10H,6-7,9H2,1-5H3,(H,15,18)/t10-/m1/s1 |
| InChIKey | VLRATUQJBOVNTF-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |