C10H19N5O — CID 94672826
4-ethyl-6-hydrazinyl-N-(2-methoxyethyl)-5-methylpyrimidin-2-amine (PubChem CID 94672826) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 4-ethyl-6-hydrazinyl-N-(2-methoxyethyl)-5-methylpyrimidin-2-amine.
| Compound Name | 4-ethyl-6-hydrazinyl-N-(2-methoxyethyl)-5-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 94672826 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 4-ethyl-6-hydrazinyl-N-(2-methoxyethyl)-5-methylpyrimidin-2-amine |
| SMILES | CCc1nc(NCCOC)nc(NN)c1C |
| InChI | InChI=1S/C10H19N5O/c1-4-8-7(2)9(15-11)14-10(13-8)12-5-6-16-3/h4-6,11H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | GJWRIKAXGOPLGO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|