C19H18ClN5O3S — CID 94709942
N-(2-chlorophenyl)-2-[2-methoxy-4-[(Z)-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]acetamide (PubChem CID 94709942) has the molecular formula C19H18ClN5O3S and a molecular weight of 431.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2-methoxy-4-[(Z)-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[2-methoxy-4-[(Z)-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 94709942 |
| Molecular Formula | C19H18ClN5O3S |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2-methoxy-4-[(Z)-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]acetamide |
| SMILES | COc1cc(/C=N\n2c(C)n[nH]c2=S)ccc1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H18ClN5O3S/c1-12-23-24-19(29)25(12)21-10-13-7-8-16(17(9-13)27-2)28-11-18(26)22-15-6-4-3-5-14(15)20/h3-10H,11H2,1-2H3,(H,22,26)(H,24,29)/b21-10- |
| InChIKey | AFRNKIZSULHGEU-FBHDLOMBSA-N |
| XLogP | 3.81 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|