C20H19N3O3S — CID 9471849
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide (PubChem CID 9471849) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide |
|---|---|
| PubChem CID | 9471849 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetamide |
| SMILES | N#Cc1ccccc1CSCCNC(=O)C[C@H]1Oc2ccccc2NC1=O |
| InChI | InChI=1S/C20H19N3O3S/c21-12-14-5-1-2-6-15(14)13-27-10-9-22-19(24)11-18-20(25)23-16-7-3-4-8-17(16)26-18/h1-8,18H,9-11,13H2,(H,22,24)(H,23,25)/t18-/m1/s1 |
| InChIKey | XLGFPFPPVSSHKT-GOSISDBHSA-N |
| XLogP | 2.70 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|