C18H23N3S — CID 94722766
2-[3-[[ethyl(2-pyridin-4-ylethyl)amino]methyl]phenyl]ethanethioamide (PubChem CID 94722766) has the molecular formula C18H23N3S and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-[3-[[ethyl(2-pyridin-4-ylethyl)amino]methyl]phenyl]ethanethioamide.
| Compound Name | 2-[3-[[ethyl(2-pyridin-4-ylethyl)amino]methyl]phenyl]ethanethioamide |
|---|---|
| PubChem CID | 94722766 |
| Molecular Formula | C18H23N3S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-[3-[[ethyl(2-pyridin-4-ylethyl)amino]methyl]phenyl]ethanethioamide |
| SMILES | CCN(CCc1ccncc1)Cc1cccc(CC(N)=S)c1 |
| InChI | InChI=1S/C18H23N3S/c1-2-21(11-8-15-6-9-20-10-7-15)14-17-5-3-4-16(12-17)13-18(19)22/h3-7,9-10,12H,2,8,11,13-14H2,1H3,(H2,19,22) |
| InChIKey | WCOXDSFERXYJLU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|