C19H18N2O2S — CID 94744468
(5S)-3-[[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]-5-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 94744468) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is (5S)-3-[[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]-5-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5S)-3-[[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]-5-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 94744468 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (5S)-3-[[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]-5-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | C[C@@H]1NC(=S)N(Cc2ccc(-c3ccc4c(c3)CCO4)cc2)C1=O |
| InChI | InChI=1S/C19H18N2O2S/c1-12-18(22)21(19(24)20-12)11-13-2-4-14(5-3-13)15-6-7-17-16(10-15)8-9-23-17/h2-7,10,12H,8-9,11H2,1H3,(H,20,24)/t12-/m0/s1 |
| InChIKey | OUPOMLHHHRZUOL-LBPRGKRZSA-N |
| XLogP | 2.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|