C15H18N2O6 — CID 94752273
2-[(4R)-4-(2,5-dimethoxyphenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 94752273) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-[(4R)-4-(2,5-dimethoxyphenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[(4R)-4-(2,5-dimethoxyphenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 94752273 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-[(4R)-4-(2,5-dimethoxyphenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | CC[C@]1(c2cc(OC)ccc2OC)NC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C15H18N2O6/c1-4-15(10-7-9(22-2)5-6-11(10)23-3)13(20)17(8-12(18)19)14(21)16-15/h5-7H,4,8H2,1-3H3,(H,16,21)(H,18,19)/t15-/m1/s1 |
| InChIKey | JZERNUJBWPCCSB-OAHLLOKOSA-N |
| XLogP | 0.95 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|