C16H20N2O3S — CID 94758974
ethyl 2-[(3-amino-4-propan-2-yloxyphenyl)methyl]-1,3-thiazole-4-carboxylate (PubChem CID 94758974) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is ethyl 2-[(3-amino-4-propan-2-yloxyphenyl)methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(3-amino-4-propan-2-yloxyphenyl)methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 94758974 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | ethyl 2-[(3-amino-4-propan-2-yloxyphenyl)methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Cc2ccc(OC(C)C)c(N)c2)n1 |
| InChI | InChI=1S/C16H20N2O3S/c1-4-20-16(19)13-9-22-15(18-13)8-11-5-6-14(12(17)7-11)21-10(2)3/h5-7,9-10H,4,8,17H2,1-3H3 |
| InChIKey | SLILSTJTYARVSK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|