C13H13NO6S — CID 94780257
(E)-4-[4-[2-(methylamino)-2-oxoethyl]sulfonylphenyl]-4-oxobut-2-enoic acid (PubChem CID 94780257) has the molecular formula C13H13NO6S and a molecular weight of 311.32 g/mol. Its IUPAC name is (E)-4-[4-[2-(methylamino)-2-oxoethyl]sulfonylphenyl]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[2-(methylamino)-2-oxoethyl]sulfonylphenyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 94780257 |
| Molecular Formula | C13H13NO6S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (E)-4-[4-[2-(methylamino)-2-oxoethyl]sulfonylphenyl]-4-oxobut-2-enoic acid |
| SMILES | CNC(=O)CS(=O)(=O)c1ccc(C(=O)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C13H13NO6S/c1-14-12(16)8-21(19,20)10-4-2-9(3-5-10)11(15)6-7-13(17)18/h2-7H,8H2,1H3,(H,14,16)(H,17,18)/b7-6+ |
| InChIKey | HXQLPPUEHCIPAY-VOTSOKGWSA-N |
| XLogP | 0.03 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|