C17H27N3O2S — CID 94798216
(2R)-2-(carbamoylamino)-N-[2-methyl-2-(3-methylphenyl)propyl]-4-methylsulfanylbutanamide (PubChem CID 94798216) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is (2R)-2-(carbamoylamino)-N-[2-methyl-2-(3-methylphenyl)propyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-(carbamoylamino)-N-[2-methyl-2-(3-methylphenyl)propyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 94798216 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (2R)-2-(carbamoylamino)-N-[2-methyl-2-(3-methylphenyl)propyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](NC(N)=O)C(=O)NCC(C)(C)c1cccc(C)c1 |
| InChI | InChI=1S/C17H27N3O2S/c1-12-6-5-7-13(10-12)17(2,3)11-19-15(21)14(8-9-23-4)20-16(18)22/h5-7,10,14H,8-9,11H2,1-4H3,(H,19,21)(H3,18,20,22)/t14-/m1/s1 |
| InChIKey | RPSAUSVTBIFXJV-CQSZACIVSA-N |
| XLogP | 2.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |