C20H14FN3O2 — CID 94798584
N-[5-[(2S)-2-cyano-2-quinolin-2-ylacetyl]-2-fluorophenyl]acetamide (PubChem CID 94798584) has the molecular formula C20H14FN3O2 and a molecular weight of 347.35 g/mol. Its IUPAC name is N-[5-[(2S)-2-cyano-2-quinolin-2-ylacetyl]-2-fluorophenyl]acetamide.
| Compound Name | N-[5-[(2S)-2-cyano-2-quinolin-2-ylacetyl]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 94798584 |
| Molecular Formula | C20H14FN3O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[5-[(2S)-2-cyano-2-quinolin-2-ylacetyl]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(=O)[C@H](C#N)c2ccc3ccccc3n2)ccc1F |
| InChI | InChI=1S/C20H14FN3O2/c1-12(25)23-19-10-14(6-8-16(19)21)20(26)15(11-22)18-9-7-13-4-2-3-5-17(13)24-18/h2-10,15H,1H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | NMWDIRXJUDZRCO-OAHLLOKOSA-N |
| XLogP | 3.82 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |