C19H21N3O2 — CID 94800890
N-[(3R)-3-cyano-2-oxo-3-quinolin-2-ylpropyl]-3,3-dimethylbutanamide (PubChem CID 94800890) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(3R)-3-cyano-2-oxo-3-quinolin-2-ylpropyl]-3,3-dimethylbutanamide.
| Compound Name | N-[(3R)-3-cyano-2-oxo-3-quinolin-2-ylpropyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 94800890 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[(3R)-3-cyano-2-oxo-3-quinolin-2-ylpropyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCC(=O)[C@@H](C#N)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H21N3O2/c1-19(2,3)10-18(24)21-12-17(23)14(11-20)16-9-8-13-6-4-5-7-15(13)22-16/h4-9,14H,10,12H2,1-3H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | SERHRMZTHHLWQQ-AWEZNQCLSA-N |
| XLogP | 2.96 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |