C14H19N3O2S2 — CID 94800017
(3S)-1-(2-prop-2-enylsulfanylacetyl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 94800017) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is (3S)-1-(2-prop-2-enylsulfanylacetyl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2-prop-2-enylsulfanylacetyl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94800017 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (3S)-1-(2-prop-2-enylsulfanylacetyl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | C=CCSCC(=O)N1CCC[C@H](C(=O)Nc2nccs2)C1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-2-7-20-10-12(18)17-6-3-4-11(9-17)13(19)16-14-15-5-8-21-14/h2,5,8,11H,1,3-4,6-7,9-10H2,(H,15,16,19)/t11-/m0/s1 |
| InChIKey | CXUKZGZBJGULQX-NSHDSACASA-N |
| XLogP | 2.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|