C18H24N4OS — CID 94802478
(E)-N-[(4R)-1-tert-butyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 94802478) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is (E)-N-[(4R)-1-tert-butyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4R)-1-tert-butyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 94802478 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (E)-N-[(4R)-1-tert-butyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)N[C@@H]2CCCc3c2cnn3C(C)(C)C)cs1 |
| InChI | InChI=1S/C18H24N4OS/c1-12-20-13(11-24-12)8-9-17(23)21-15-6-5-7-16-14(15)10-19-22(16)18(2,3)4/h8-11,15H,5-7H2,1-4H3,(H,21,23)/b9-8+/t15-/m1/s1 |
| InChIKey | LHPPKEDMMUAZQI-XVJNWHFHSA-N |
| XLogP | 3.61 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|