C19H25FN2O5 — CID 94820306
ethyl (3R)-1-[(2S)-2-(2-amino-5-fluoro-3-methylbenzoyl)oxypropanoyl]piperidine-3-carboxylate (PubChem CID 94820306) has the molecular formula C19H25FN2O5 and a molecular weight of 380.42 g/mol. Its IUPAC name is ethyl (3R)-1-[(2S)-2-(2-amino-5-fluoro-3-methylbenzoyl)oxypropanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(2S)-2-(2-amino-5-fluoro-3-methylbenzoyl)oxypropanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 94820306 |
| Molecular Formula | C19H25FN2O5 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | ethyl (3R)-1-[(2S)-2-(2-amino-5-fluoro-3-methylbenzoyl)oxypropanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)[C@H](C)OC(=O)c2cc(F)cc(C)c2N)C1 |
| InChI | InChI=1S/C19H25FN2O5/c1-4-26-18(24)13-6-5-7-22(10-13)17(23)12(3)27-19(25)15-9-14(20)8-11(2)16(15)21/h8-9,12-13H,4-7,10,21H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | MRIXFOZVTIEJOI-QWHCGFSZSA-N |
| XLogP | 2.06 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|