C13H20N4O2 — CID 94822181
(2S)-N,N-diethyl-2-(pyridin-4-ylcarbamoylamino)propanamide (PubChem CID 94822181) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is (2S)-N,N-diethyl-2-(pyridin-4-ylcarbamoylamino)propanamide.
| Compound Name | (2S)-N,N-diethyl-2-(pyridin-4-ylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 94822181 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (2S)-N,N-diethyl-2-(pyridin-4-ylcarbamoylamino)propanamide |
| SMILES | CCN(CC)C(=O)[C@H](C)NC(=O)Nc1ccncc1 |
| InChI | InChI=1S/C13H20N4O2/c1-4-17(5-2)12(18)10(3)15-13(19)16-11-6-8-14-9-7-11/h6-10H,4-5H2,1-3H3,(H2,14,15,16,19)/t10-/m0/s1 |
| InChIKey | YQQVKKBOOUSSNS-JTQLQIEISA-N |
| XLogP | 1.46 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |