C19H26N2O3 — CID 94823521
4-[[cyclopropyl-[(2S)-2-(cyclopropylmethoxy)propanoyl]amino]methyl]-N-methylbenzamide (PubChem CID 94823521) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[[cyclopropyl-[(2S)-2-(cyclopropylmethoxy)propanoyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[cyclopropyl-[(2S)-2-(cyclopropylmethoxy)propanoyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 94823521 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 4-[[cyclopropyl-[(2S)-2-(cyclopropylmethoxy)propanoyl]amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN(C(=O)[C@H](C)OCC2CC2)C2CC2)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-13(24-12-15-3-4-15)19(23)21(17-9-10-17)11-14-5-7-16(8-6-14)18(22)20-2/h5-8,13,15,17H,3-4,9-12H2,1-2H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | QTUQCSXQRMTGFM-ZDUSSCGKSA-N |
| XLogP | 2.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |