About 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea
1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea (PubChem CID 94826245) has the molecular formula C13H19BrN2OS
and a molecular weight of 331.28 g/mol. Its IUPAC name is 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea.
Molecular Properties
| Compound Name | 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea |
| PubChem CID | 94826245 |
| Molecular Formula | C13H19BrN2OS |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)N[C@H](C)[C@@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H19BrN2OS/c1-8(2)15-13(18)16-9(3)12(17)10-4-6-11(14)7-5-10/h4-9,12,17H,1-3H3,(H2,15,16,18)/t9-,12-/m1/s1 |
| InChIKey | JFBVCDLYDXWVHW-BXKDBHETSA-N |
| XLogP | 2.74 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea?
The IUPAC name of 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea (CID 94826245) is 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea.
What is the SMILES notation for 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea?
The canonical SMILES for 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea is CC(C)NC(=S)N[C@H](C)[C@@H](O)c1ccc(Br)cc1.
What is the InChIKey of 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea?
The InChIKey is JFBVCDLYDXWVHW-BXKDBHETSA-N. The full InChI is InChI=1S/C13H19BrN2OS/c1-8(2)15-13(18)16-9(3)12(17)10-4-6-11(14)7-5-10/h4-9,12,17H,1-3H3,(H2,15,16,18)/t9-,12-/m1/s1.
What are the key properties of 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea?
1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea has a molecular weight of 331.28 g/mol, XLogP of 2.74, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-1-(4-bromophenyl)-1-hydroxypropan-2-yl]-3-propan-2-ylthiourea is sourced from PubChem (CID 94826245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).