C20H31NO3 — CID 94828161
ethyl (3S)-1-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]piperidine-3-carboxylate (PubChem CID 94828161) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is ethyl (3S)-1-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 94828161 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | ethyl (3S)-1-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(Cc2cc(C)cc(C(C)(C)C)c2O)C1 |
| InChI | InChI=1S/C20H31NO3/c1-6-24-19(23)15-8-7-9-21(12-15)13-16-10-14(2)11-17(18(16)22)20(3,4)5/h10-11,15,22H,6-9,12-13H2,1-5H3/t15-/m0/s1 |
| InChIKey | ITPKBYIVRRRUPV-HNNXBMFYSA-N |
| XLogP | 3.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|