5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid

C15H9Cl2NO2 — CID 94830117

IUPAC5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid
SMILESO=C(O)c1[nH]c2c(Cl)cc(Cl)cc2c1-c1ccccc1
InChIInChI=1S/C15H9Cl2NO2/c16-9-6-10-12(8-4-2-1-3-5-8)14(15(19)20)18-13(10)11(17)7-9/h1-7,18H,(H,19,20)
InChIKeyDOEDHZFENDCFAJ-UHFFFAOYSA-N
MW306.15 g/mol
LogP4.84
Rot. Bonds2

About 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid

5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid (PubChem CID 94830117) has the molecular formula C15H9Cl2NO2 and a molecular weight of 306.15 g/mol. Its IUPAC name is 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid.

Molecular Properties

Compound Name5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid
PubChem CID94830117
Molecular FormulaC15H9Cl2NO2
Molecular Weight306.15 g/mol
Exact Mass305.00
IUPAC Name5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid
SMILESO=C(O)c1[nH]c2c(Cl)cc(Cl)cc2c1-c1ccccc1
InChIInChI=1S/C15H9Cl2NO2/c16-9-6-10-12(8-4-2-1-3-5-8)14(15(19)20)18-13(10)11(17)7-9/h1-7,18H,(H,19,20)
InChIKeyDOEDHZFENDCFAJ-UHFFFAOYSA-N
XLogP4.84
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.15
LogP ≤ 54.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid?
The IUPAC name of 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid (CID 94830117) is 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid.
What is the SMILES notation for 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid?
The canonical SMILES for 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid is O=C(O)c1[nH]c2c(Cl)cc(Cl)cc2c1-c1ccccc1.
What is the InChIKey of 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid?
The InChIKey is DOEDHZFENDCFAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2NO2/c16-9-6-10-12(8-4-2-1-3-5-8)14(15(19)20)18-13(10)11(17)7-9/h1-7,18H,(H,19,20).
What are the key properties of 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid?
5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid has a molecular weight of 306.15 g/mol, XLogP of 4.84, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid is sourced from PubChem (CID 94830117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).