C15H9Cl2NO2 — CID 94830117
5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid (PubChem CID 94830117) has the molecular formula C15H9Cl2NO2 and a molecular weight of 306.15 g/mol. Its IUPAC name is 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid.
| Compound Name | 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 94830117 |
| Molecular Formula | C15H9Cl2NO2 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 5,7-dichloro-3-phenyl-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2c(Cl)cc(Cl)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C15H9Cl2NO2/c16-9-6-10-12(8-4-2-1-3-5-8)14(15(19)20)18-13(10)11(17)7-9/h1-7,18H,(H,19,20) |
| InChIKey | DOEDHZFENDCFAJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |